C20H30N2 — CID 143238386
N-ethyl-N,4-dimethylaniline;2-methylcyclohepta-1,3,5-triene;N-methylmethanimine (PubChem CID 143238386) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is N-ethyl-N,4-dimethylaniline;2-methylcyclohepta-1,3,5-triene;N-methylmethanimine.
| Compound Name | N-ethyl-N,4-dimethylaniline;2-methylcyclohepta-1,3,5-triene;N-methylmethanimine |
|---|---|
| PubChem CID | 143238386 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | N-ethyl-N,4-dimethylaniline;2-methylcyclohepta-1,3,5-triene;N-methylmethanimine |
| SMILES | C=NC.CC1=CCC=CC=C1.CCN(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C10H15N.C8H10.C2H5N/c1-4-11(3)10-7-5-9(2)6-8-10;1-8-6-4-2-3-5-7-8;1-3-2/h5-8H,4H2,1-3H3;2-4,6-7H,5H2,1H3;1H2,2H3 |
| InChIKey | JFZZBDZJBACWMV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|