C12H18O3 — CID 143238612
4-butyl-5-methoxy-2-methylbenzene-1,3-diol (PubChem CID 143238612) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 4-butyl-5-methoxy-2-methylbenzene-1,3-diol.
| Compound Name | 4-butyl-5-methoxy-2-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 143238612 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 4-butyl-5-methoxy-2-methylbenzene-1,3-diol |
| SMILES | CCCCc1c(OC)cc(O)c(C)c1O |
| InChI | InChI=1S/C12H18O3/c1-4-5-6-9-11(15-3)7-10(13)8(2)12(9)14/h7,13-14H,4-6H2,1-3H3 |
| InChIKey | QZHPLJKFCZTTHR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |