About 4-[(1R)-cyclohex-2-en-1-yl]butan-1-ol;N,N-dimethylacetamide
4-[(1R)-cyclohex-2-en-1-yl]butan-1-ol;N,N-dimethylacetamide (PubChem CID 143238683) has the molecular formula C14H27NO2
and a molecular weight of 241.37 g/mol. Its IUPAC name is 4-[(1R)-cyclohex-2-en-1-yl]butan-1-ol;N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 4-[(1R)-cyclohex-2-en-1-yl]butan-1-ol;N,N-dimethylacetamide |
| PubChem CID | 143238683 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 4-[(1R)-cyclohex-2-en-1-yl]butan-1-ol;N,N-dimethylacetamide |
| SMILES | CC(=O)N(C)C.OCCCC[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C10H18O.C4H9NO/c11-9-5-4-8-10-6-2-1-3-7-10;1-4(6)5(2)3/h2,6,10-11H,1,3-5,7-9H2;1-3H3/t10-;/m1./s1 |
| InChIKey | BCPHTPGKAYDHIG-HNCPQSOCSA-N |
| XLogP | 2.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1R)-cyclohex-2-en-1-yl]butan-1-ol;N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R)-cyclohex-2-en-1-yl]butan-1-ol;N,N-dimethylacetamide?
The IUPAC name of 4-[(1R)-cyclohex-2-en-1-yl]butan-1-ol;N,N-dimethylacetamide (CID 143238683) is 4-[(1R)-cyclohex-2-en-1-yl]butan-1-ol;N,N-dimethylacetamide.
What is the SMILES notation for 4-[(1R)-cyclohex-2-en-1-yl]butan-1-ol;N,N-dimethylacetamide?
The canonical SMILES for 4-[(1R)-cyclohex-2-en-1-yl]butan-1-ol;N,N-dimethylacetamide is CC(=O)N(C)C.OCCCC[C@@H]1C=CCCC1.
What is the InChIKey of 4-[(1R)-cyclohex-2-en-1-yl]butan-1-ol;N,N-dimethylacetamide?
The InChIKey is BCPHTPGKAYDHIG-HNCPQSOCSA-N. The full InChI is InChI=1S/C10H18O.C4H9NO/c11-9-5-4-8-10-6-2-1-3-7-10;1-4(6)5(2)3/h2,6,10-11H,1,3-5,7-9H2;1-3H3/t10-;/m1./s1.
What are the key properties of 4-[(1R)-cyclohex-2-en-1-yl]butan-1-ol;N,N-dimethylacetamide?
4-[(1R)-cyclohex-2-en-1-yl]butan-1-ol;N,N-dimethylacetamide has a molecular weight of 241.37 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R)-cyclohex-2-en-1-yl]butan-1-ol;N,N-dimethylacetamide is sourced from PubChem (CID 143238683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).