C18H32O3 — CID 143238722
(7S)-1,4-dioxadispiro[4.1.57.35]pentadec-9-ene-10-carbaldehyde;ethane (PubChem CID 143238722) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-9-ene-10-carbaldehyde;ethane.
| Compound Name | (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-9-ene-10-carbaldehyde;ethane |
|---|---|
| PubChem CID | 143238722 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | (7S)-1,4-dioxadispiro[4.1.57.35]pentadec-9-ene-10-carbaldehyde;ethane |
| SMILES | CC.CC.O=CC1=CC[C@]2(CCCC3(C2)OCCO3)CC1 |
| InChI | InChI=1S/C14H20O3.2C2H6/c15-10-12-2-6-13(7-3-12)4-1-5-14(11-13)16-8-9-17-14;2*1-2/h2,10H,1,3-9,11H2;2*1-2H3/t13-;;/m1../s1 |
| InChIKey | PIIPAURNZSQVFA-FFXKMJQXSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|