C13H18N3O2+ — CID 143239451
7-[(3R,5S)-3,5-dimethylpiperazin-4-ium-1-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 143239451) has the molecular formula C13H18N3O2+ and a molecular weight of 248.31 g/mol. Its IUPAC name is 7-[(3R,5S)-3,5-dimethylpiperazin-4-ium-1-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 7-[(3R,5S)-3,5-dimethylpiperazin-4-ium-1-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 143239451 |
| Molecular Formula | C13H18N3O2+ |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 7-[(3R,5S)-3,5-dimethylpiperazin-4-ium-1-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | C[C@@H]1CN(c2cccc3[nH]c(=O)oc23)C[C@H](C)[NH2+]1 |
| InChI | InChI=1S/C13H17N3O2/c1-8-6-16(7-9(2)14-8)11-5-3-4-10-12(11)18-13(17)15-10/h3-5,8-9,14H,6-7H2,1-2H3,(H,15,17)/p+1/t8-,9+ |
| InChIKey | ARUKSVSYWGZPRT-DTORHVGOSA-O |
| XLogP | 0.28 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |