C15H14N2O4 — CID 143240345
12-methyl-5-propyl-5,12-diazatricyclo[8.3.0.03,7]trideca-1(10),2,7-triene-4,6,11,13-tetrone (PubChem CID 143240345) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 12-methyl-5-propyl-5,12-diazatricyclo[8.3.0.03,7]trideca-1(10),2,7-triene-4,6,11,13-tetrone.
| Compound Name | 12-methyl-5-propyl-5,12-diazatricyclo[8.3.0.03,7]trideca-1(10),2,7-triene-4,6,11,13-tetrone |
|---|---|
| PubChem CID | 143240345 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 12-methyl-5-propyl-5,12-diazatricyclo[8.3.0.03,7]trideca-1(10),2,7-triene-4,6,11,13-tetrone |
| SMILES | CCCN1C(=O)C2=CCC3=C(C=C2C1=O)C(=O)N(C)C3=O |
| InChI | InChI=1S/C15H14N2O4/c1-3-6-17-14(20)9-5-4-8-10(7-11(9)15(17)21)13(19)16(2)12(8)18/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | ZWDCRVZJNQIXFV-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|