About ethane;(4Z)-4-methanimidoyl-1-(4-methylpiperazin-1-yl)hepta-4,6-dien-1-one
ethane;(4Z)-4-methanimidoyl-1-(4-methylpiperazin-1-yl)hepta-4,6-dien-1-one (PubChem CID 143240409) has the molecular formula C15H27N3O
and a molecular weight of 265.40 g/mol. Its IUPAC name is ethane;(4Z)-4-methanimidoyl-1-(4-methylpiperazin-1-yl)hepta-4,6-dien-1-one.
Molecular Properties
| Compound Name | ethane;(4Z)-4-methanimidoyl-1-(4-methylpiperazin-1-yl)hepta-4,6-dien-1-one |
| PubChem CID | 143240409 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | ethane;(4Z)-4-methanimidoyl-1-(4-methylpiperazin-1-yl)hepta-4,6-dien-1-one |
| SMILES | CC.[H]/N=C/C(=C\C=C)CCC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C13H21N3O.C2H6/c1-3-4-12(11-14)5-6-13(17)16-9-7-15(2)8-10-16;1-2/h3-4,11,14H,1,5-10H2,2H3;1-2H3/b12-4-,14-11+; |
| InChIKey | NCYIEIQPSFNDNC-GNXSBIDOSA-N |
| XLogP | 2.33 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(4Z)-4-methanimidoyl-1-(4-methylpiperazin-1-yl)hepta-4,6-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4Z)-4-methanimidoyl-1-(4-methylpiperazin-1-yl)hepta-4,6-dien-1-one?
The IUPAC name of ethane;(4Z)-4-methanimidoyl-1-(4-methylpiperazin-1-yl)hepta-4,6-dien-1-one (CID 143240409) is ethane;(4Z)-4-methanimidoyl-1-(4-methylpiperazin-1-yl)hepta-4,6-dien-1-one.
What is the SMILES notation for ethane;(4Z)-4-methanimidoyl-1-(4-methylpiperazin-1-yl)hepta-4,6-dien-1-one?
The canonical SMILES for ethane;(4Z)-4-methanimidoyl-1-(4-methylpiperazin-1-yl)hepta-4,6-dien-1-one is CC.[H]/N=C/C(=C\C=C)CCC(=O)N1CCN(C)CC1.
What is the InChIKey of ethane;(4Z)-4-methanimidoyl-1-(4-methylpiperazin-1-yl)hepta-4,6-dien-1-one?
The InChIKey is NCYIEIQPSFNDNC-GNXSBIDOSA-N. The full InChI is InChI=1S/C13H21N3O.C2H6/c1-3-4-12(11-14)5-6-13(17)16-9-7-15(2)8-10-16;1-2/h3-4,11,14H,1,5-10H2,2H3;1-2H3/b12-4-,14-11+;.
What are the key properties of ethane;(4Z)-4-methanimidoyl-1-(4-methylpiperazin-1-yl)hepta-4,6-dien-1-one?
ethane;(4Z)-4-methanimidoyl-1-(4-methylpiperazin-1-yl)hepta-4,6-dien-1-one has a molecular weight of 265.40 g/mol, XLogP of 2.33, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4Z)-4-methanimidoyl-1-(4-methylpiperazin-1-yl)hepta-4,6-dien-1-one is sourced from PubChem (CID 143240409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).