C12H14F3N3O3 — CID 143240981
(Z)-3-[2-(2,2-dimethyl-3-oxopiperazin-1-yl)-2-oxoethoxy]-4,4,4-trifluorobut-2-enenitrile (PubChem CID 143240981) has the molecular formula C12H14F3N3O3 and a molecular weight of 305.26 g/mol. Its IUPAC name is (Z)-3-[2-(2,2-dimethyl-3-oxopiperazin-1-yl)-2-oxoethoxy]-4,4,4-trifluorobut-2-enenitrile.
| Compound Name | (Z)-3-[2-(2,2-dimethyl-3-oxopiperazin-1-yl)-2-oxoethoxy]-4,4,4-trifluorobut-2-enenitrile |
|---|---|
| PubChem CID | 143240981 |
| Molecular Formula | C12H14F3N3O3 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | (Z)-3-[2-(2,2-dimethyl-3-oxopiperazin-1-yl)-2-oxoethoxy]-4,4,4-trifluorobut-2-enenitrile |
| SMILES | CC1(C)C(=O)NCCN1C(=O)CO/C(=C\C#N)C(F)(F)F |
| InChI | InChI=1S/C12H14F3N3O3/c1-11(2)10(20)17-5-6-18(11)9(19)7-21-8(3-4-16)12(13,14)15/h3H,5-7H2,1-2H3,(H,17,20)/b8-3- |
| InChIKey | OQBIZJLXTPQSPR-BAQGIRSFSA-N |
| XLogP | 0.71 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|