About 2-(4-methyl-7-oxo-1,4-diazepan-1-yl)acetamide
2-(4-methyl-7-oxo-1,4-diazepan-1-yl)acetamide (PubChem CID 143241112) has the molecular formula C8H15N3O2
and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-(4-methyl-7-oxo-1,4-diazepan-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4-methyl-7-oxo-1,4-diazepan-1-yl)acetamide |
| PubChem CID | 143241112 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2-(4-methyl-7-oxo-1,4-diazepan-1-yl)acetamide |
| SMILES | CN1CCC(=O)N(CC(N)=O)CC1 |
| InChI | InChI=1S/C8H15N3O2/c1-10-3-2-8(13)11(5-4-10)6-7(9)12/h2-6H2,1H3,(H2,9,12) |
| InChIKey | LXPHLYPZQCHFIK-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methyl-7-oxo-1,4-diazepan-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-7-oxo-1,4-diazepan-1-yl)acetamide?
The IUPAC name of 2-(4-methyl-7-oxo-1,4-diazepan-1-yl)acetamide (CID 143241112) is 2-(4-methyl-7-oxo-1,4-diazepan-1-yl)acetamide.
What is the SMILES notation for 2-(4-methyl-7-oxo-1,4-diazepan-1-yl)acetamide?
The canonical SMILES for 2-(4-methyl-7-oxo-1,4-diazepan-1-yl)acetamide is CN1CCC(=O)N(CC(N)=O)CC1.
What is the InChIKey of 2-(4-methyl-7-oxo-1,4-diazepan-1-yl)acetamide?
The InChIKey is LXPHLYPZQCHFIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O2/c1-10-3-2-8(13)11(5-4-10)6-7(9)12/h2-6H2,1H3,(H2,9,12).
What are the key properties of 2-(4-methyl-7-oxo-1,4-diazepan-1-yl)acetamide?
2-(4-methyl-7-oxo-1,4-diazepan-1-yl)acetamide has a molecular weight of 185.23 g/mol, XLogP of -1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-7-oxo-1,4-diazepan-1-yl)acetamide is sourced from PubChem (CID 143241112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).