C25H35NO3 — CID 143241157
5,6-dimethoxy-2-(piperidin-4-ylmethyl)-2,3-dihydroinden-1-one;(3Z,5Z)-2-methylhepta-1,3,5-triene (PubChem CID 143241157) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is 5,6-dimethoxy-2-(piperidin-4-ylmethyl)-2,3-dihydroinden-1-one;(3Z,5Z)-2-methylhepta-1,3,5-triene.
| Compound Name | 5,6-dimethoxy-2-(piperidin-4-ylmethyl)-2,3-dihydroinden-1-one;(3Z,5Z)-2-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143241157 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 5,6-dimethoxy-2-(piperidin-4-ylmethyl)-2,3-dihydroinden-1-one;(3Z,5Z)-2-methylhepta-1,3,5-triene |
| SMILES | C=C(C)/C=C\C=C/C.COc1cc2c(cc1OC)C(=O)C(CC1CCNCC1)C2 |
| InChI | InChI=1S/C17H23NO3.C8H12/c1-20-15-9-12-8-13(7-11-3-5-18-6-4-11)17(19)14(12)10-16(15)21-2;1-4-5-6-7-8(2)3/h9-11,13,18H,3-8H2,1-2H3;4-7H,2H2,1,3H3/b;5-4-,7-6- |
| InChIKey | DWKXMRPSGGYMHN-ZBRBURFXSA-N |
| XLogP | 5.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|