About aminomethyl (2Z)-N-amino-5-(2-methylpropyl)pyridine-2-carboximidothioate
aminomethyl (2Z)-N-amino-5-(2-methylpropyl)pyridine-2-carboximidothioate (PubChem CID 143241201) has the molecular formula C11H18N4S
and a molecular weight of 238.36 g/mol. Its IUPAC name is aminomethyl (2Z)-N-amino-5-(2-methylpropyl)pyridine-2-carboximidothioate.
Molecular Properties
| Compound Name | aminomethyl (2Z)-N-amino-5-(2-methylpropyl)pyridine-2-carboximidothioate |
| PubChem CID | 143241201 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | aminomethyl (2Z)-N-amino-5-(2-methylpropyl)pyridine-2-carboximidothioate |
| SMILES | CC(C)Cc1ccc(/C(=N/N)SCN)nc1 |
| InChI | InChI=1S/C11H18N4S/c1-8(2)5-9-3-4-10(14-6-9)11(15-13)16-7-12/h3-4,6,8H,5,7,12-13H2,1-2H3/b15-11- |
| InChIKey | DXUJWQLJNCGPKJ-PTNGSMBKSA-N |
| XLogP | 1.55 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze aminomethyl (2Z)-N-amino-5-(2-methylpropyl)pyridine-2-carboximidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminomethyl (2Z)-N-amino-5-(2-methylpropyl)pyridine-2-carboximidothioate?
The IUPAC name of aminomethyl (2Z)-N-amino-5-(2-methylpropyl)pyridine-2-carboximidothioate (CID 143241201) is aminomethyl (2Z)-N-amino-5-(2-methylpropyl)pyridine-2-carboximidothioate.
What is the SMILES notation for aminomethyl (2Z)-N-amino-5-(2-methylpropyl)pyridine-2-carboximidothioate?
The canonical SMILES for aminomethyl (2Z)-N-amino-5-(2-methylpropyl)pyridine-2-carboximidothioate is CC(C)Cc1ccc(/C(=N/N)SCN)nc1.
What is the InChIKey of aminomethyl (2Z)-N-amino-5-(2-methylpropyl)pyridine-2-carboximidothioate?
The InChIKey is DXUJWQLJNCGPKJ-PTNGSMBKSA-N. The full InChI is InChI=1S/C11H18N4S/c1-8(2)5-9-3-4-10(14-6-9)11(15-13)16-7-12/h3-4,6,8H,5,7,12-13H2,1-2H3/b15-11-.
What are the key properties of aminomethyl (2Z)-N-amino-5-(2-methylpropyl)pyridine-2-carboximidothioate?
aminomethyl (2Z)-N-amino-5-(2-methylpropyl)pyridine-2-carboximidothioate has a molecular weight of 238.36 g/mol, XLogP of 1.55, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for aminomethyl (2Z)-N-amino-5-(2-methylpropyl)pyridine-2-carboximidothioate is sourced from PubChem (CID 143241201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).