C23H17FN4O2 — CID 143241329
4-[1-[2-amino-5-(3-aminoisoquinolin-1-yl)-3-pyridinyl]ethenyl]-2-fluorobenzoic acid (PubChem CID 143241329) has the molecular formula C23H17FN4O2 and a molecular weight of 400.41 g/mol. Its IUPAC name is 4-[1-[2-amino-5-(3-aminoisoquinolin-1-yl)-3-pyridinyl]ethenyl]-2-fluorobenzoic acid.
| Compound Name | 4-[1-[2-amino-5-(3-aminoisoquinolin-1-yl)-3-pyridinyl]ethenyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 143241329 |
| Molecular Formula | C23H17FN4O2 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 4-[1-[2-amino-5-(3-aminoisoquinolin-1-yl)-3-pyridinyl]ethenyl]-2-fluorobenzoic acid |
| SMILES | C=C(c1ccc(C(=O)O)c(F)c1)c1cc(-c2nc(N)cc3ccccc23)cnc1N |
| InChI | InChI=1S/C23H17FN4O2/c1-12(13-6-7-17(23(29)30)19(24)9-13)18-8-15(11-27-22(18)26)21-16-5-3-2-4-14(16)10-20(25)28-21/h2-11H,1H2,(H2,25,28)(H2,26,27)(H,29,30) |
| InChIKey | RXBBFMCTDNFPNF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |