C16H25BO4 — CID 143241345
2,3-dimethylbutan-2-yloxy-[4-(1-methoxy-1-oxopropan-2-yl)phenyl]borinic acid (PubChem CID 143241345) has the molecular formula C16H25BO4 and a molecular weight of 292.18 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yloxy-[4-(1-methoxy-1-oxopropan-2-yl)phenyl]borinic acid.
| Compound Name | 2,3-dimethylbutan-2-yloxy-[4-(1-methoxy-1-oxopropan-2-yl)phenyl]borinic acid |
|---|---|
| PubChem CID | 143241345 |
| Molecular Formula | C16H25BO4 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2,3-dimethylbutan-2-yloxy-[4-(1-methoxy-1-oxopropan-2-yl)phenyl]borinic acid |
| SMILES | COC(=O)C(C)c1ccc(B(O)OC(C)(C)C(C)C)cc1 |
| InChI | InChI=1S/C16H25BO4/c1-11(2)16(4,5)21-17(19)14-9-7-13(8-10-14)12(3)15(18)20-6/h7-12,19H,1-6H3 |
| InChIKey | BNCQNBCSEZPIPW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|