C24H41F3N2 — CID 143241849
N',N'-diethyl-N-[(3Z,5E,6E,7Z)-10,10,10-trifluoro-5-prop-2-enylidene-6-propylidenedeca-3,7-dienyl]ethane-1,2-diamine;ethane (PubChem CID 143241849) has the molecular formula C24H41F3N2 and a molecular weight of 414.60 g/mol. Its IUPAC name is N',N'-diethyl-N-[(3Z,5E,6E,7Z)-10,10,10-trifluoro-5-prop-2-enylidene-6-propylidenedeca-3,7-dienyl]ethane-1,2-diamine;ethane.
| Compound Name | N',N'-diethyl-N-[(3Z,5E,6E,7Z)-10,10,10-trifluoro-5-prop-2-enylidene-6-propylidenedeca-3,7-dienyl]ethane-1,2-diamine;ethane |
|---|---|
| PubChem CID | 143241849 |
| Molecular Formula | C24H41F3N2 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | N',N'-diethyl-N-[(3Z,5E,6E,7Z)-10,10,10-trifluoro-5-prop-2-enylidene-6-propylidenedeca-3,7-dienyl]ethane-1,2-diamine;ethane |
| SMILES | C=C/C=C(\C=C/CCNCCN(CC)CC)C(C=CCC(F)(F)F)=CCC.CC |
| InChI | InChI=1S/C22H35F3N2.C2H6/c1-5-12-20(21(13-6-2)15-11-16-22(23,24)25)14-9-10-17-26-18-19-27(7-3)8-4;1-2/h5,9,11-15,26H,1,6-8,10,16-19H2,2-4H3;1-2H3/b14-9-,15-11-,20-12+,21-13+; |
| InChIKey | GWXFPHOLDVYHCI-FDHFFHLZSA-N |
| XLogP | 6.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|