C26H36N4O3S — CID 143242106
prop-2-enyl 2-cyano-2-[3-ethyl-4-oxo-5-[[3-(3-piperidin-1-ylpropyl)anilino]methyl]-1,3-thiazolidin-2-yl]acetate (PubChem CID 143242106) has the molecular formula C26H36N4O3S and a molecular weight of 484.67 g/mol. Its IUPAC name is prop-2-enyl 2-cyano-2-[3-ethyl-4-oxo-5-[[3-(3-piperidin-1-ylpropyl)anilino]methyl]-1,3-thiazolidin-2-yl]acetate.
| Compound Name | prop-2-enyl 2-cyano-2-[3-ethyl-4-oxo-5-[[3-(3-piperidin-1-ylpropyl)anilino]methyl]-1,3-thiazolidin-2-yl]acetate |
|---|---|
| PubChem CID | 143242106 |
| Molecular Formula | C26H36N4O3S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | prop-2-enyl 2-cyano-2-[3-ethyl-4-oxo-5-[[3-(3-piperidin-1-ylpropyl)anilino]methyl]-1,3-thiazolidin-2-yl]acetate |
| SMILES | C=CCOC(=O)C(C#N)C1SC(CNc2cccc(CCCN3CCCCC3)c2)C(=O)N1CC |
| InChI | InChI=1S/C26H36N4O3S/c1-3-16-33-26(32)22(18-27)25-30(4-2)24(31)23(34-25)19-28-21-12-8-10-20(17-21)11-9-15-29-13-6-5-7-14-29/h3,8,10,12,17,22-23,25,28H,1,4-7,9,11,13-16,19H2,2H3 |
| InChIKey | HOMPXXXYNGVGPW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|