C10H19N3O2S — CID 143242206
(2R)-2-cyano-N-ethyl-3-[2-(ethylamino)-2-oxoethyl]sulfanylpropanamide;molecular hydrogen (PubChem CID 143242206) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is (2R)-2-cyano-N-ethyl-3-[2-(ethylamino)-2-oxoethyl]sulfanylpropanamide;molecular hydrogen.
| Compound Name | (2R)-2-cyano-N-ethyl-3-[2-(ethylamino)-2-oxoethyl]sulfanylpropanamide;molecular hydrogen |
|---|---|
| PubChem CID | 143242206 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (2R)-2-cyano-N-ethyl-3-[2-(ethylamino)-2-oxoethyl]sulfanylpropanamide;molecular hydrogen |
| SMILES | CCNC(=O)CSC[C@H](C#N)C(=O)NCC.[H][H] |
| InChI | InChI=1S/C10H17N3O2S.H2/c1-3-12-9(14)7-16-6-8(5-11)10(15)13-4-2;/h8H,3-4,6-7H2,1-2H3,(H,12,14)(H,13,15);1H/t8-;/m0./s1 |
| InChIKey | BAJAZNCSXJELLS-QRPNPIFTSA-N |
| XLogP | 0.38 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |