C37H45F3N4O2 — CID 143242619
N-[2-(dimethylamino)ethyl]-2-[(2-methyl-5-phenylpent-2-en-3-yl)-[(Z)-2-oxopentan-3-ylideneamino]amino]-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]acetamide (PubChem CID 143242619) has the molecular formula C37H45F3N4O2 and a molecular weight of 634.79 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-[(2-methyl-5-phenylpent-2-en-3-yl)-[(Z)-2-oxopentan-3-ylideneamino]amino]-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]acetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-[(2-methyl-5-phenylpent-2-en-3-yl)-[(Z)-2-oxopentan-3-ylideneamino]amino]-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 143242619 |
| Molecular Formula | C37H45F3N4O2 |
| Molecular Weight | 634.79 g/mol |
| Exact Mass | 634.35 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-[(2-methyl-5-phenylpent-2-en-3-yl)-[(Z)-2-oxopentan-3-ylideneamino]amino]-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]acetamide |
| SMILES | CC/C(=N/N(CC(=O)N(CCN(C)C)Cc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)C(CCc1ccccc1)=C(C)C)C(C)=O |
| InChI | InChI=1S/C37H45F3N4O2/c1-7-34(28(4)45)41-44(35(27(2)3)22-15-29-11-9-8-10-12-29)26-36(46)43(24-23-42(5)6)25-30-13-16-31(17-14-30)32-18-20-33(21-19-32)37(38,39)40/h8-14,16-21H,7,15,22-26H2,1-6H3/b41-34- |
| InChIKey | GBTUBRALDJAFJR-HSRGEJEPSA-N |
| XLogP | 7.85 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.79 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|