C13H21N — CID 143243657
prop-1-ene;(2,4,5-trimethylcyclohexa-2,4-dien-1-yl)methanimine (PubChem CID 143243657) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is prop-1-ene;(2,4,5-trimethylcyclohexa-2,4-dien-1-yl)methanimine.
| Compound Name | prop-1-ene;(2,4,5-trimethylcyclohexa-2,4-dien-1-yl)methanimine |
|---|---|
| PubChem CID | 143243657 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | prop-1-ene;(2,4,5-trimethylcyclohexa-2,4-dien-1-yl)methanimine |
| SMILES | C=CC.[H]/N=C/C1CC(C)=C(C)C=C1C |
| InChI | InChI=1S/C10H15N.C3H6/c1-7-4-9(3)10(6-11)5-8(7)2;1-3-2/h4,6,10-11H,5H2,1-3H3;3H,1H2,2H3/b11-6+; |
| InChIKey | RTMBLEFPWRJHGZ-ICSBZGNSSA-N |
| XLogP | 4.13 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|