C10H15N — CID 143243658
(2,4,5-trimethylcyclohexa-2,4-dien-1-yl)methanimine (PubChem CID 143243658) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (2,4,5-trimethylcyclohexa-2,4-dien-1-yl)methanimine.
| Compound Name | (2,4,5-trimethylcyclohexa-2,4-dien-1-yl)methanimine |
|---|---|
| PubChem CID | 143243658 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (2,4,5-trimethylcyclohexa-2,4-dien-1-yl)methanimine |
| SMILES | [H]/N=C/C1CC(C)=C(C)C=C1C |
| InChI | InChI=1S/C10H15N/c1-7-4-9(3)10(6-11)5-8(7)2/h4,6,10-11H,5H2,1-3H3/b11-6+ |
| InChIKey | YCPVXYZFGFOWGR-IZZDOVSWSA-N |
| XLogP | 2.94 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|