C8H10F2O — CID 143243673
(3Z)-2-ethoxy-3,4-difluorohexa-1,3,5-triene (PubChem CID 143243673) has the molecular formula C8H10F2O and a molecular weight of 160.16 g/mol. Its IUPAC name is (3Z)-2-ethoxy-3,4-difluorohexa-1,3,5-triene.
| Compound Name | (3Z)-2-ethoxy-3,4-difluorohexa-1,3,5-triene |
|---|---|
| PubChem CID | 143243673 |
| Molecular Formula | C8H10F2O |
| Molecular Weight | 160.16 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (3Z)-2-ethoxy-3,4-difluorohexa-1,3,5-triene |
| SMILES | C=C/C(F)=C(/F)C(=C)OCC |
| InChI | InChI=1S/C8H10F2O/c1-4-7(9)8(10)6(3)11-5-2/h4H,1,3,5H2,2H3/b8-7- |
| InChIKey | FIQOETGNVPFFST-FPLPWBNLSA-N |
| XLogP | 2.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.16 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|