About 2-amino-4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-phenyl-1H-imidazol-5-one
2-amino-4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-phenyl-1H-imidazol-5-one (PubChem CID 143244461) has the molecular formula C15H17N3O
and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-amino-4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-phenyl-1H-imidazol-5-one.
Molecular Properties
| Compound Name | 2-amino-4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-phenyl-1H-imidazol-5-one |
| PubChem CID | 143244461 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-amino-4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-phenyl-1H-imidazol-5-one |
| SMILES | C/C=C\C=C(/C)C1(c2ccccc2)N=C(N)NC1=O |
| InChI | InChI=1S/C15H17N3O/c1-3-4-8-11(2)15(12-9-6-5-7-10-12)13(19)17-14(16)18-15/h3-10H,1-2H3,(H3,16,17,18,19)/b4-3-,11-8+ |
| InChIKey | XIIQABZTUIZONG-PRTWDDKSSA-N |
| XLogP | 1.85 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-phenyl-1H-imidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-phenyl-1H-imidazol-5-one?
The IUPAC name of 2-amino-4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-phenyl-1H-imidazol-5-one (CID 143244461) is 2-amino-4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-phenyl-1H-imidazol-5-one.
What is the SMILES notation for 2-amino-4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-phenyl-1H-imidazol-5-one?
The canonical SMILES for 2-amino-4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-phenyl-1H-imidazol-5-one is C/C=C\C=C(/C)C1(c2ccccc2)N=C(N)NC1=O.
What is the InChIKey of 2-amino-4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-phenyl-1H-imidazol-5-one?
The InChIKey is XIIQABZTUIZONG-PRTWDDKSSA-N. The full InChI is InChI=1S/C15H17N3O/c1-3-4-8-11(2)15(12-9-6-5-7-10-12)13(19)17-14(16)18-15/h3-10H,1-2H3,(H3,16,17,18,19)/b4-3-,11-8+.
What are the key properties of 2-amino-4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-phenyl-1H-imidazol-5-one?
2-amino-4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-phenyl-1H-imidazol-5-one has a molecular weight of 255.32 g/mol, XLogP of 1.85, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-phenyl-1H-imidazol-5-one is sourced from PubChem (CID 143244461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).