About (3Z)-3-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)penta-1,3-dien-2-ol
(3Z)-3-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)penta-1,3-dien-2-ol (PubChem CID 143244830) has the molecular formula C17H18FN3O
and a molecular weight of 299.35 g/mol. Its IUPAC name is (3Z)-3-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)penta-1,3-dien-2-ol.
Molecular Properties
| Compound Name | (3Z)-3-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)penta-1,3-dien-2-ol |
| PubChem CID | 143244830 |
| Molecular Formula | C17H18FN3O |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (3Z)-3-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)penta-1,3-dien-2-ol |
| SMILES | C=C(O)/C(=C\C)c1nc(N2CCCC2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C17H18FN3O/c1-3-13(11(2)22)16-19-15-7-6-12(18)10-14(15)17(20-16)21-8-4-5-9-21/h3,6-7,10,22H,2,4-5,8-9H2,1H3/b13-3+ |
| InChIKey | MUSFWNQODUYBNW-QLKAYGNNSA-N |
| XLogP | 3.84 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)penta-1,3-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)penta-1,3-dien-2-ol?
The IUPAC name of (3Z)-3-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)penta-1,3-dien-2-ol (CID 143244830) is (3Z)-3-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)penta-1,3-dien-2-ol.
What is the SMILES notation for (3Z)-3-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)penta-1,3-dien-2-ol?
The canonical SMILES for (3Z)-3-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)penta-1,3-dien-2-ol is C=C(O)/C(=C\C)c1nc(N2CCCC2)c2cc(F)ccc2n1.
What is the InChIKey of (3Z)-3-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)penta-1,3-dien-2-ol?
The InChIKey is MUSFWNQODUYBNW-QLKAYGNNSA-N. The full InChI is InChI=1S/C17H18FN3O/c1-3-13(11(2)22)16-19-15-7-6-12(18)10-14(15)17(20-16)21-8-4-5-9-21/h3,6-7,10,22H,2,4-5,8-9H2,1H3/b13-3+.
What are the key properties of (3Z)-3-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)penta-1,3-dien-2-ol?
(3Z)-3-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)penta-1,3-dien-2-ol has a molecular weight of 299.35 g/mol, XLogP of 3.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-(6-fluoro-4-pyrrolidin-1-ylquinazolin-2-yl)penta-1,3-dien-2-ol is sourced from PubChem (CID 143244830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).