About 2-[6-fluoro-4-(3-methylbutylamino)quinazolin-2-yl]phenol;methanamine
2-[6-fluoro-4-(3-methylbutylamino)quinazolin-2-yl]phenol;methanamine (PubChem CID 143244887) has the molecular formula C20H25FN4O
and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-[6-fluoro-4-(3-methylbutylamino)quinazolin-2-yl]phenol;methanamine.
Molecular Properties
| Compound Name | 2-[6-fluoro-4-(3-methylbutylamino)quinazolin-2-yl]phenol;methanamine |
| PubChem CID | 143244887 |
| Molecular Formula | C20H25FN4O |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 2-[6-fluoro-4-(3-methylbutylamino)quinazolin-2-yl]phenol;methanamine |
| SMILES | CC(C)CCNc1nc(-c2ccccc2O)nc2ccc(F)cc12.CN |
| InChI | InChI=1S/C19H20FN3O.CH5N/c1-12(2)9-10-21-18-15-11-13(20)7-8-16(15)22-19(23-18)14-5-3-4-6-17(14)24;1-2/h3-8,11-12,24H,9-10H2,1-2H3,(H,21,22,23);2H2,1H3 |
| InChIKey | CPINTKHLKIFGJJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[6-fluoro-4-(3-methylbutylamino)quinazolin-2-yl]phenol;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-fluoro-4-(3-methylbutylamino)quinazolin-2-yl]phenol;methanamine?
The IUPAC name of 2-[6-fluoro-4-(3-methylbutylamino)quinazolin-2-yl]phenol;methanamine (CID 143244887) is 2-[6-fluoro-4-(3-methylbutylamino)quinazolin-2-yl]phenol;methanamine.
What is the SMILES notation for 2-[6-fluoro-4-(3-methylbutylamino)quinazolin-2-yl]phenol;methanamine?
The canonical SMILES for 2-[6-fluoro-4-(3-methylbutylamino)quinazolin-2-yl]phenol;methanamine is CC(C)CCNc1nc(-c2ccccc2O)nc2ccc(F)cc12.CN.
What is the InChIKey of 2-[6-fluoro-4-(3-methylbutylamino)quinazolin-2-yl]phenol;methanamine?
The InChIKey is CPINTKHLKIFGJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FN3O.CH5N/c1-12(2)9-10-21-18-15-11-13(20)7-8-16(15)22-19(23-18)14-5-3-4-6-17(14)24;1-2/h3-8,11-12,24H,9-10H2,1-2H3,(H,21,22,23);2H2,1H3.
What are the key properties of 2-[6-fluoro-4-(3-methylbutylamino)quinazolin-2-yl]phenol;methanamine?
2-[6-fluoro-4-(3-methylbutylamino)quinazolin-2-yl]phenol;methanamine has a molecular weight of 356.45 g/mol, XLogP of 4.17, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-fluoro-4-(3-methylbutylamino)quinazolin-2-yl]phenol;methanamine is sourced from PubChem (CID 143244887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).