About ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate
ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate (PubChem CID 143244896) has the molecular formula C18H34N2O2
and a molecular weight of 310.48 g/mol. Its IUPAC name is ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate.
Molecular Properties
| Compound Name | ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate |
| PubChem CID | 143244896 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate |
| SMILES | C=C/C=C(\C=C)COC(=O)NCC1CCCNC1.CC.CC |
| InChI | InChI=1S/C14H22N2O2.2C2H6/c1-3-6-12(4-2)11-18-14(17)16-10-13-7-5-8-15-9-13;2*1-2/h3-4,6,13,15H,1-2,5,7-11H2,(H,16,17);2*1-2H3/b12-6+;; |
| InChIKey | COZYENSDEFSZDT-HTFHIHPASA-N |
| XLogP | 4.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate?
The IUPAC name of ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate (CID 143244896) is ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate.
What is the SMILES notation for ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate?
The canonical SMILES for ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate is C=C/C=C(\C=C)COC(=O)NCC1CCCNC1.CC.CC.
What is the InChIKey of ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate?
The InChIKey is COZYENSDEFSZDT-HTFHIHPASA-N. The full InChI is InChI=1S/C14H22N2O2.2C2H6/c1-3-6-12(4-2)11-18-14(17)16-10-13-7-5-8-15-9-13;2*1-2/h3-4,6,13,15H,1-2,5,7-11H2,(H,16,17);2*1-2H3/b12-6+;;.
What are the key properties of ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate?
ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate has a molecular weight of 310.48 g/mol, XLogP of 4.06, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(2E)-2-ethenylpenta-2,4-dienyl] N-(piperidin-3-ylmethyl)carbamate is sourced from PubChem (CID 143244896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).