C18H23FN4O — CID 143244920
(2E,4E)-4-(5-ethenyl-4-methyl-6-piperazin-1-ylpyrimidin-2-yl)-5-fluorohepta-2,4,6-trien-3-ol (PubChem CID 143244920) has the molecular formula C18H23FN4O and a molecular weight of 330.41 g/mol. Its IUPAC name is (2E,4E)-4-(5-ethenyl-4-methyl-6-piperazin-1-ylpyrimidin-2-yl)-5-fluorohepta-2,4,6-trien-3-ol.
| Compound Name | (2E,4E)-4-(5-ethenyl-4-methyl-6-piperazin-1-ylpyrimidin-2-yl)-5-fluorohepta-2,4,6-trien-3-ol |
|---|---|
| PubChem CID | 143244920 |
| Molecular Formula | C18H23FN4O |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (2E,4E)-4-(5-ethenyl-4-methyl-6-piperazin-1-ylpyrimidin-2-yl)-5-fluorohepta-2,4,6-trien-3-ol |
| SMILES | C=C/C(F)=C(C(\O)=C/C)/c1nc(C)c(C=C)c(N2CCNCC2)n1 |
| InChI | InChI=1S/C18H23FN4O/c1-5-13-12(4)21-17(16(14(19)6-2)15(24)7-3)22-18(13)23-10-8-20-9-11-23/h5-7,20,24H,1-2,8-11H2,3-4H3/b15-7+,16-14- |
| InChIKey | MQDPROVTOBCHNK-ASTBXTISSA-N |
| XLogP | 3.17 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|