C8H13NO2 — CID 143245209
(3E)-4,5-dimethoxyhexa-1,3,5-trien-2-amine (PubChem CID 143245209) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (3E)-4,5-dimethoxyhexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-4,5-dimethoxyhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143245209 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (3E)-4,5-dimethoxyhexa-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C=C(/OC)C(=C)OC |
| InChI | InChI=1S/C8H13NO2/c1-6(9)5-8(11-4)7(2)10-3/h5H,1-2,9H2,3-4H3/b8-5+ |
| InChIKey | CGGCJEVJDJKGQU-VMPITWQZSA-N |
| XLogP | 1.15 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|