About 2-(5-methylthiophen-3-yl)-2,3-dihydropyridine
2-(5-methylthiophen-3-yl)-2,3-dihydropyridine (PubChem CID 143245934) has the molecular formula C10H11NS
and a molecular weight of 177.27 g/mol. Its IUPAC name is 2-(5-methylthiophen-3-yl)-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 2-(5-methylthiophen-3-yl)-2,3-dihydropyridine |
| PubChem CID | 143245934 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 2-(5-methylthiophen-3-yl)-2,3-dihydropyridine |
| SMILES | Cc1cc(C2CC=CC=N2)cs1 |
| InChI | InChI=1S/C10H11NS/c1-8-6-9(7-12-8)10-4-2-3-5-11-10/h2-3,5-7,10H,4H2,1H3 |
| InChIKey | LWPXDFSZGUUVEV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-methylthiophen-3-yl)-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methylthiophen-3-yl)-2,3-dihydropyridine?
The IUPAC name of 2-(5-methylthiophen-3-yl)-2,3-dihydropyridine (CID 143245934) is 2-(5-methylthiophen-3-yl)-2,3-dihydropyridine.
What is the SMILES notation for 2-(5-methylthiophen-3-yl)-2,3-dihydropyridine?
The canonical SMILES for 2-(5-methylthiophen-3-yl)-2,3-dihydropyridine is Cc1cc(C2CC=CC=N2)cs1.
What is the InChIKey of 2-(5-methylthiophen-3-yl)-2,3-dihydropyridine?
The InChIKey is LWPXDFSZGUUVEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NS/c1-8-6-9(7-12-8)10-4-2-3-5-11-10/h2-3,5-7,10H,4H2,1H3.
What are the key properties of 2-(5-methylthiophen-3-yl)-2,3-dihydropyridine?
2-(5-methylthiophen-3-yl)-2,3-dihydropyridine has a molecular weight of 177.27 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methylthiophen-3-yl)-2,3-dihydropyridine is sourced from PubChem (CID 143245934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).