C14H19N3O — CID 143246222
N-[(2E,4E)-5-[(2-methylimidazol-1-yl)methyl]hepta-2,4,6-trien-3-yl]acetamide (PubChem CID 143246222) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is N-[(2E,4E)-5-[(2-methylimidazol-1-yl)methyl]hepta-2,4,6-trien-3-yl]acetamide.
| Compound Name | N-[(2E,4E)-5-[(2-methylimidazol-1-yl)methyl]hepta-2,4,6-trien-3-yl]acetamide |
|---|---|
| PubChem CID | 143246222 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-[(2E,4E)-5-[(2-methylimidazol-1-yl)methyl]hepta-2,4,6-trien-3-yl]acetamide |
| SMILES | C=C/C(=C\C(=C/C)NC(C)=O)Cn1ccnc1C |
| InChI | InChI=1S/C14H19N3O/c1-5-13(9-14(6-2)16-12(4)18)10-17-8-7-15-11(17)3/h5-9H,1,10H2,2-4H3,(H,16,18)/b13-9+,14-6+ |
| InChIKey | WYUVDYYQSFNGDY-WSPXSRFVSA-N |
| XLogP | 2.34 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|