About N-benzyl-N-[3-[(4-methylimidazol-1-yl)methyl]phenyl]formamide;butane
N-benzyl-N-[3-[(4-methylimidazol-1-yl)methyl]phenyl]formamide;butane (PubChem CID 143246286) has the molecular formula C23H29N3O
and a molecular weight of 363.51 g/mol. Its IUPAC name is N-benzyl-N-[3-[(4-methylimidazol-1-yl)methyl]phenyl]formamide;butane.
Molecular Properties
| Compound Name | N-benzyl-N-[3-[(4-methylimidazol-1-yl)methyl]phenyl]formamide;butane |
| PubChem CID | 143246286 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | N-benzyl-N-[3-[(4-methylimidazol-1-yl)methyl]phenyl]formamide;butane |
| SMILES | CCCC.Cc1cn(Cc2cccc(N(C=O)Cc3ccccc3)c2)cn1 |
| InChI | InChI=1S/C19H19N3O.C4H10/c1-16-11-21(14-20-16)12-18-8-5-9-19(10-18)22(15-23)13-17-6-3-2-4-7-17;1-3-4-2/h2-11,14-15H,12-13H2,1H3;3-4H2,1-2H3 |
| InChIKey | YTYXJIPGKZJULB-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N-[3-[(4-methylimidazol-1-yl)methyl]phenyl]formamide;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-[3-[(4-methylimidazol-1-yl)methyl]phenyl]formamide;butane?
The IUPAC name of N-benzyl-N-[3-[(4-methylimidazol-1-yl)methyl]phenyl]formamide;butane (CID 143246286) is N-benzyl-N-[3-[(4-methylimidazol-1-yl)methyl]phenyl]formamide;butane.
What is the SMILES notation for N-benzyl-N-[3-[(4-methylimidazol-1-yl)methyl]phenyl]formamide;butane?
The canonical SMILES for N-benzyl-N-[3-[(4-methylimidazol-1-yl)methyl]phenyl]formamide;butane is CCCC.Cc1cn(Cc2cccc(N(C=O)Cc3ccccc3)c2)cn1.
What is the InChIKey of N-benzyl-N-[3-[(4-methylimidazol-1-yl)methyl]phenyl]formamide;butane?
The InChIKey is YTYXJIPGKZJULB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O.C4H10/c1-16-11-21(14-20-16)12-18-8-5-9-19(10-18)22(15-23)13-17-6-3-2-4-7-17;1-3-4-2/h2-11,14-15H,12-13H2,1H3;3-4H2,1-2H3.
What are the key properties of N-benzyl-N-[3-[(4-methylimidazol-1-yl)methyl]phenyl]formamide;butane?
N-benzyl-N-[3-[(4-methylimidazol-1-yl)methyl]phenyl]formamide;butane has a molecular weight of 363.51 g/mol, XLogP of 5.21, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-[3-[(4-methylimidazol-1-yl)methyl]phenyl]formamide;butane is sourced from PubChem (CID 143246286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).