About ethane;N,5,5-trimethylthian-3-amine
ethane;N,5,5-trimethylthian-3-amine (PubChem CID 143246348) has the molecular formula C10H23NS
and a molecular weight of 189.37 g/mol. Its IUPAC name is ethane;N,5,5-trimethylthian-3-amine.
Molecular Properties
| Compound Name | ethane;N,5,5-trimethylthian-3-amine |
| PubChem CID | 143246348 |
| Molecular Formula | C10H23NS |
| Molecular Weight | 189.37 g/mol |
| Exact Mass | 189.16 |
| IUPAC Name | ethane;N,5,5-trimethylthian-3-amine |
| SMILES | CC.CNC1CSCC(C)(C)C1 |
| InChI | InChI=1S/C8H17NS.C2H6/c1-8(2)4-7(9-3)5-10-6-8;1-2/h7,9H,4-6H2,1-3H3;1-2H3 |
| InChIKey | UGPVIKNYHGOCCV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N,5,5-trimethylthian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N,5,5-trimethylthian-3-amine?
The IUPAC name of ethane;N,5,5-trimethylthian-3-amine (CID 143246348) is ethane;N,5,5-trimethylthian-3-amine.
What is the SMILES notation for ethane;N,5,5-trimethylthian-3-amine?
The canonical SMILES for ethane;N,5,5-trimethylthian-3-amine is CC.CNC1CSCC(C)(C)C1.
What is the InChIKey of ethane;N,5,5-trimethylthian-3-amine?
The InChIKey is UGPVIKNYHGOCCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NS.C2H6/c1-8(2)4-7(9-3)5-10-6-8;1-2/h7,9H,4-6H2,1-3H3;1-2H3.
What are the key properties of ethane;N,5,5-trimethylthian-3-amine?
ethane;N,5,5-trimethylthian-3-amine has a molecular weight of 189.37 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N,5,5-trimethylthian-3-amine is sourced from PubChem (CID 143246348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).