C19H23NO3 — CID 143246783
prop-2-enyl 4-cyclopropyl-2,7,7-trimethyl-5-oxo-6,8-dihydroquinoline-3-carboxylate (PubChem CID 143246783) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is prop-2-enyl 4-cyclopropyl-2,7,7-trimethyl-5-oxo-6,8-dihydroquinoline-3-carboxylate.
| Compound Name | prop-2-enyl 4-cyclopropyl-2,7,7-trimethyl-5-oxo-6,8-dihydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 143246783 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | prop-2-enyl 4-cyclopropyl-2,7,7-trimethyl-5-oxo-6,8-dihydroquinoline-3-carboxylate |
| SMILES | C=CCOC(=O)c1c(C)nc2c(c1C1CC1)C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C19H23NO3/c1-5-8-23-18(22)15-11(2)20-13-9-19(3,4)10-14(21)17(13)16(15)12-6-7-12/h5,12H,1,6-10H2,2-4H3 |
| InChIKey | RFNXKMYNRAETNX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|