1-ethyl-1-methylimidazol-1-ium chloride

C6H11ClN2 — CID 14324718

IUPAC1-ethyl-1-methylimidazol-1-ium chloride
SMILESCC[N+]1(C)C=CN=C1.[Cl-]
InChIInChI=1S/C6H11N2.ClH/c1-3-8(2)5-4-7-6-8;/h4-6H,3H2,1-2H3;1H/q+1;/p-1
InChIKeyBUGSKAHJUIWIKQ-UHFFFAOYSA-M
MW146.62 g/mol
LogP-2.03
Rot. Bonds1

About 1-ethyl-1-methylimidazol-1-ium chloride

1-ethyl-1-methylimidazol-1-ium chloride (PubChem CID 14324718) has the molecular formula C6H11ClN2 and a molecular weight of 146.62 g/mol. Its IUPAC name is 1-ethyl-1-methylimidazol-1-ium chloride.

Molecular Properties

Compound Name1-ethyl-1-methylimidazol-1-ium chloride
PubChem CID14324718
Molecular FormulaC6H11ClN2
Molecular Weight146.62 g/mol
Exact Mass146.06
IUPAC Name1-ethyl-1-methylimidazol-1-ium chloride
SMILESCC[N+]1(C)C=CN=C1.[Cl-]
InChIInChI=1S/C6H11N2.ClH/c1-3-8(2)5-4-7-6-8;/h4-6H,3H2,1-2H3;1H/q+1;/p-1
InChIKeyBUGSKAHJUIWIKQ-UHFFFAOYSA-M
XLogP-2.03
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.62
LogP ≤ 5-2.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze 1-ethyl-1-methylimidazol-1-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethyl-1-methylimidazol-1-ium chloride?
The IUPAC name of 1-ethyl-1-methylimidazol-1-ium chloride (CID 14324718) is 1-ethyl-1-methylimidazol-1-ium chloride.
What is the SMILES notation for 1-ethyl-1-methylimidazol-1-ium chloride?
The canonical SMILES for 1-ethyl-1-methylimidazol-1-ium chloride is CC[N+]1(C)C=CN=C1.[Cl-].
What is the InChIKey of 1-ethyl-1-methylimidazol-1-ium chloride?
The InChIKey is BUGSKAHJUIWIKQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H11N2.ClH/c1-3-8(2)5-4-7-6-8;/h4-6H,3H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 1-ethyl-1-methylimidazol-1-ium chloride?
1-ethyl-1-methylimidazol-1-ium chloride has a molecular weight of 146.62 g/mol, XLogP of -2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-methylimidazol-1-ium chloride is sourced from PubChem (CID 14324718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).