About butan-2-one;2-ethyl-4-(fluoromethyl)-1-methylbenzene
butan-2-one;2-ethyl-4-(fluoromethyl)-1-methylbenzene (PubChem CID 143248151) has the molecular formula C14H21FO
and a molecular weight of 224.32 g/mol. Its IUPAC name is butan-2-one;2-ethyl-4-(fluoromethyl)-1-methylbenzene.
Molecular Properties
| Compound Name | butan-2-one;2-ethyl-4-(fluoromethyl)-1-methylbenzene |
| PubChem CID | 143248151 |
| Molecular Formula | C14H21FO |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | butan-2-one;2-ethyl-4-(fluoromethyl)-1-methylbenzene |
| SMILES | CCC(C)=O.CCc1cc(CF)ccc1C |
| InChI | InChI=1S/C10H13F.C4H8O/c1-3-10-6-9(7-11)5-4-8(10)2;1-3-4(2)5/h4-6H,3,7H2,1-2H3;3H2,1-2H3 |
| InChIKey | ZOOIFJMRLSTLFG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butan-2-one;2-ethyl-4-(fluoromethyl)-1-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;2-ethyl-4-(fluoromethyl)-1-methylbenzene?
The IUPAC name of butan-2-one;2-ethyl-4-(fluoromethyl)-1-methylbenzene (CID 143248151) is butan-2-one;2-ethyl-4-(fluoromethyl)-1-methylbenzene.
What is the SMILES notation for butan-2-one;2-ethyl-4-(fluoromethyl)-1-methylbenzene?
The canonical SMILES for butan-2-one;2-ethyl-4-(fluoromethyl)-1-methylbenzene is CCC(C)=O.CCc1cc(CF)ccc1C.
What is the InChIKey of butan-2-one;2-ethyl-4-(fluoromethyl)-1-methylbenzene?
The InChIKey is ZOOIFJMRLSTLFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F.C4H8O/c1-3-10-6-9(7-11)5-4-8(10)2;1-3-4(2)5/h4-6H,3,7H2,1-2H3;3H2,1-2H3.
What are the key properties of butan-2-one;2-ethyl-4-(fluoromethyl)-1-methylbenzene?
butan-2-one;2-ethyl-4-(fluoromethyl)-1-methylbenzene has a molecular weight of 224.32 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;2-ethyl-4-(fluoromethyl)-1-methylbenzene is sourced from PubChem (CID 143248151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).