About 4-[(1E)-buta-1,3-dienoxy]-N,2-dimethylbutan-1-amine
4-[(1E)-buta-1,3-dienoxy]-N,2-dimethylbutan-1-amine (PubChem CID 143248170) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 4-[(1E)-buta-1,3-dienoxy]-N,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 4-[(1E)-buta-1,3-dienoxy]-N,2-dimethylbutan-1-amine |
| PubChem CID | 143248170 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 4-[(1E)-buta-1,3-dienoxy]-N,2-dimethylbutan-1-amine |
| SMILES | C=C/C=C/OCCC(C)CNC |
| InChI | InChI=1S/C10H19NO/c1-4-5-7-12-8-6-10(2)9-11-3/h4-5,7,10-11H,1,6,8-9H2,2-3H3/b7-5+ |
| InChIKey | SQIDMMZYKCDDNK-FNORWQNLSA-N |
| XLogP | 1.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1E)-buta-1,3-dienoxy]-N,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1E)-buta-1,3-dienoxy]-N,2-dimethylbutan-1-amine?
The IUPAC name of 4-[(1E)-buta-1,3-dienoxy]-N,2-dimethylbutan-1-amine (CID 143248170) is 4-[(1E)-buta-1,3-dienoxy]-N,2-dimethylbutan-1-amine.
What is the SMILES notation for 4-[(1E)-buta-1,3-dienoxy]-N,2-dimethylbutan-1-amine?
The canonical SMILES for 4-[(1E)-buta-1,3-dienoxy]-N,2-dimethylbutan-1-amine is C=C/C=C/OCCC(C)CNC.
What is the InChIKey of 4-[(1E)-buta-1,3-dienoxy]-N,2-dimethylbutan-1-amine?
The InChIKey is SQIDMMZYKCDDNK-FNORWQNLSA-N. The full InChI is InChI=1S/C10H19NO/c1-4-5-7-12-8-6-10(2)9-11-3/h4-5,7,10-11H,1,6,8-9H2,2-3H3/b7-5+.
What are the key properties of 4-[(1E)-buta-1,3-dienoxy]-N,2-dimethylbutan-1-amine?
4-[(1E)-buta-1,3-dienoxy]-N,2-dimethylbutan-1-amine has a molecular weight of 169.27 g/mol, XLogP of 1.95, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1E)-buta-1,3-dienoxy]-N,2-dimethylbutan-1-amine is sourced from PubChem (CID 143248170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).