C10H11NS — CID 143248532
5,5-dimethylthieno[2,3-c]azepine (PubChem CID 143248532) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is 5,5-dimethylthieno[2,3-c]azepine.
| Compound Name | 5,5-dimethylthieno[2,3-c]azepine |
|---|---|
| PubChem CID | 143248532 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 5,5-dimethylthieno[2,3-c]azepine |
| SMILES | CC1(C)C=NC=c2sccc2=C1 |
| InChI | InChI=1S/C10H11NS/c1-10(2)5-8-3-4-12-9(8)6-11-7-10/h3-7H,1-2H3 |
| InChIKey | JXGABKKGUXFVEJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |