About ethane;8H-pyridazino[4,3-b]azepine
ethane;8H-pyridazino[4,3-b]azepine (PubChem CID 143248602) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is ethane;8H-pyridazino[4,3-b]azepine.
Molecular Properties
| Compound Name | ethane;8H-pyridazino[4,3-b]azepine |
| PubChem CID | 143248602 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | ethane;8H-pyridazino[4,3-b]azepine |
| SMILES | C1=CN=c2ccnnc2=CC1.CC |
| InChI | InChI=1S/C8H7N3.C2H6/c1-2-5-9-7-4-6-10-11-8(7)3-1;1-2/h2-6H,1H2;1-2H3 |
| InChIKey | JSVUFQCXTOMDJX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;8H-pyridazino[4,3-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;8H-pyridazino[4,3-b]azepine?
The IUPAC name of ethane;8H-pyridazino[4,3-b]azepine (CID 143248602) is ethane;8H-pyridazino[4,3-b]azepine.
What is the SMILES notation for ethane;8H-pyridazino[4,3-b]azepine?
The canonical SMILES for ethane;8H-pyridazino[4,3-b]azepine is C1=CN=c2ccnnc2=CC1.CC.
What is the InChIKey of ethane;8H-pyridazino[4,3-b]azepine?
The InChIKey is JSVUFQCXTOMDJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.C2H6/c1-2-5-9-7-4-6-10-11-8(7)3-1;1-2/h2-6H,1H2;1-2H3.
What are the key properties of ethane;8H-pyridazino[4,3-b]azepine?
ethane;8H-pyridazino[4,3-b]azepine has a molecular weight of 175.23 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;8H-pyridazino[4,3-b]azepine is sourced from PubChem (CID 143248602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).