C28H43N3O4 — CID 143248741
4-methoxy-3-(3-methoxypropoxy)-N-propan-2-yl-N-(pyrrolidin-3-ylmethyl)benzamide;N-methyl-1-phenylmethanamine (PubChem CID 143248741) has the molecular formula C28H43N3O4 and a molecular weight of 485.67 g/mol. Its IUPAC name is 4-methoxy-3-(3-methoxypropoxy)-N-propan-2-yl-N-(pyrrolidin-3-ylmethyl)benzamide;N-methyl-1-phenylmethanamine.
| Compound Name | 4-methoxy-3-(3-methoxypropoxy)-N-propan-2-yl-N-(pyrrolidin-3-ylmethyl)benzamide;N-methyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 143248741 |
| Molecular Formula | C28H43N3O4 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | 4-methoxy-3-(3-methoxypropoxy)-N-propan-2-yl-N-(pyrrolidin-3-ylmethyl)benzamide;N-methyl-1-phenylmethanamine |
| SMILES | CNCc1ccccc1.COCCCOc1cc(C(=O)N(CC2CCNC2)C(C)C)ccc1OC |
| InChI | InChI=1S/C20H32N2O4.C8H11N/c1-15(2)22(14-16-8-9-21-13-16)20(23)17-6-7-18(25-4)19(12-17)26-11-5-10-24-3;1-9-7-8-5-3-2-4-6-8/h6-7,12,15-16,21H,5,8-11,13-14H2,1-4H3;2-6,9H,7H2,1H3 |
| InChIKey | NCKFVPGYBHXYQT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|