About 6-methyl-3,4-dihydro-2H-cyclohepta[b][1,4]oxazin-6-amine
6-methyl-3,4-dihydro-2H-cyclohepta[b][1,4]oxazin-6-amine (PubChem CID 143248770) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is 6-methyl-3,4-dihydro-2H-cyclohepta[b][1,4]oxazin-6-amine.
Molecular Properties
| Compound Name | 6-methyl-3,4-dihydro-2H-cyclohepta[b][1,4]oxazin-6-amine |
| PubChem CID | 143248770 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 6-methyl-3,4-dihydro-2H-cyclohepta[b][1,4]oxazin-6-amine |
| SMILES | CC1(N)C=CC=C2OCCNC2=C1 |
| InChI | InChI=1S/C10H14N2O/c1-10(11)4-2-3-9-8(7-10)12-5-6-13-9/h2-4,7,12H,5-6,11H2,1H3 |
| InChIKey | NQLPDXNOIHPLBH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-3,4-dihydro-2H-cyclohepta[b][1,4]oxazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3,4-dihydro-2H-cyclohepta[b][1,4]oxazin-6-amine?
The IUPAC name of 6-methyl-3,4-dihydro-2H-cyclohepta[b][1,4]oxazin-6-amine (CID 143248770) is 6-methyl-3,4-dihydro-2H-cyclohepta[b][1,4]oxazin-6-amine.
What is the SMILES notation for 6-methyl-3,4-dihydro-2H-cyclohepta[b][1,4]oxazin-6-amine?
The canonical SMILES for 6-methyl-3,4-dihydro-2H-cyclohepta[b][1,4]oxazin-6-amine is CC1(N)C=CC=C2OCCNC2=C1.
What is the InChIKey of 6-methyl-3,4-dihydro-2H-cyclohepta[b][1,4]oxazin-6-amine?
The InChIKey is NQLPDXNOIHPLBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-10(11)4-2-3-9-8(7-10)12-5-6-13-9/h2-4,7,12H,5-6,11H2,1H3.
What are the key properties of 6-methyl-3,4-dihydro-2H-cyclohepta[b][1,4]oxazin-6-amine?
6-methyl-3,4-dihydro-2H-cyclohepta[b][1,4]oxazin-6-amine has a molecular weight of 178.23 g/mol, XLogP of 0.66, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3,4-dihydro-2H-cyclohepta[b][1,4]oxazin-6-amine is sourced from PubChem (CID 143248770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).