C20H28N4 — CID 143249050
cyclohexane;6-methyl-5-[(3-methylphenyl)methyliminomethyl]pyrimidin-4-amine (PubChem CID 143249050) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is cyclohexane;6-methyl-5-[(3-methylphenyl)methyliminomethyl]pyrimidin-4-amine.
| Compound Name | cyclohexane;6-methyl-5-[(3-methylphenyl)methyliminomethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 143249050 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | cyclohexane;6-methyl-5-[(3-methylphenyl)methyliminomethyl]pyrimidin-4-amine |
| SMILES | C1CCCCC1.Cc1cccc(C/N=C/c2c(C)ncnc2N)c1 |
| InChI | InChI=1S/C14H16N4.C6H12/c1-10-4-3-5-12(6-10)7-16-8-13-11(2)17-9-18-14(13)15;1-2-4-6-5-3-1/h3-6,8-9H,7H2,1-2H3,(H2,15,17,18);1-6H2/b16-8+; |
| InChIKey | RPEVYPLPEVDYLG-OHGISNTKSA-N |
| XLogP | 4.64 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|