About N-methyl-[1,3]thiazolo[4,5-f]quinolin-9-amine
N-methyl-[1,3]thiazolo[4,5-f]quinolin-9-amine (PubChem CID 143249252) has the molecular formula C11H9N3S
and a molecular weight of 215.28 g/mol. Its IUPAC name is N-methyl-[1,3]thiazolo[4,5-f]quinolin-9-amine.
Molecular Properties
| Compound Name | N-methyl-[1,3]thiazolo[4,5-f]quinolin-9-amine |
| PubChem CID | 143249252 |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | N-methyl-[1,3]thiazolo[4,5-f]quinolin-9-amine |
| SMILES | CNc1ccnc2ccc3scnc3c12 |
| InChI | InChI=1S/C11H9N3S/c1-12-7-4-5-13-8-2-3-9-11(10(7)8)14-6-15-9/h2-6H,1H3,(H,12,13) |
| InChIKey | ZYWQHDWCKPUPOX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-[1,3]thiazolo[4,5-f]quinolin-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-[1,3]thiazolo[4,5-f]quinolin-9-amine?
The IUPAC name of N-methyl-[1,3]thiazolo[4,5-f]quinolin-9-amine (CID 143249252) is N-methyl-[1,3]thiazolo[4,5-f]quinolin-9-amine.
What is the SMILES notation for N-methyl-[1,3]thiazolo[4,5-f]quinolin-9-amine?
The canonical SMILES for N-methyl-[1,3]thiazolo[4,5-f]quinolin-9-amine is CNc1ccnc2ccc3scnc3c12.
What is the InChIKey of N-methyl-[1,3]thiazolo[4,5-f]quinolin-9-amine?
The InChIKey is ZYWQHDWCKPUPOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3S/c1-12-7-4-5-13-8-2-3-9-11(10(7)8)14-6-15-9/h2-6H,1H3,(H,12,13).
What are the key properties of N-methyl-[1,3]thiazolo[4,5-f]quinolin-9-amine?
N-methyl-[1,3]thiazolo[4,5-f]quinolin-9-amine has a molecular weight of 215.28 g/mol, XLogP of 2.89, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-[1,3]thiazolo[4,5-f]quinolin-9-amine is sourced from PubChem (CID 143249252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).