C26H32F6N2O2 — CID 143249871
N,N-dimethyl-1-[methylamino(phenyl)methyl]cyclopentan-1-amine;2-ethoxy-4,6-bis(trifluoromethyl)benzaldehyde (PubChem CID 143249871) has the molecular formula C26H32F6N2O2 and a molecular weight of 518.54 g/mol. Its IUPAC name is N,N-dimethyl-1-[methylamino(phenyl)methyl]cyclopentan-1-amine;2-ethoxy-4,6-bis(trifluoromethyl)benzaldehyde.
| Compound Name | N,N-dimethyl-1-[methylamino(phenyl)methyl]cyclopentan-1-amine;2-ethoxy-4,6-bis(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 143249871 |
| Molecular Formula | C26H32F6N2O2 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | N,N-dimethyl-1-[methylamino(phenyl)methyl]cyclopentan-1-amine;2-ethoxy-4,6-bis(trifluoromethyl)benzaldehyde |
| SMILES | CCOc1cc(C(F)(F)F)cc(C(F)(F)F)c1C=O.CNC(c1ccccc1)C1(N(C)C)CCCC1 |
| InChI | InChI=1S/C15H24N2.C11H8F6O2/c1-16-14(13-9-5-4-6-10-13)15(17(2)3)11-7-8-12-15;1-2-19-9-4-6(10(12,13)14)3-8(7(9)5-18)11(15,16)17/h4-6,9-10,14,16H,7-8,11-12H2,1-3H3;3-5H,2H2,1H3 |
| InChIKey | XBPKGOHAFHOYOO-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|