C12H18F2O — CID 143250931
(3E,5Z)-4-(difluoromethoxy)-5-ethylidene-7-methylocta-1,3-diene (PubChem CID 143250931) has the molecular formula C12H18F2O and a molecular weight of 216.27 g/mol. Its IUPAC name is (3E,5Z)-4-(difluoromethoxy)-5-ethylidene-7-methylocta-1,3-diene.
| Compound Name | (3E,5Z)-4-(difluoromethoxy)-5-ethylidene-7-methylocta-1,3-diene |
|---|---|
| PubChem CID | 143250931 |
| Molecular Formula | C12H18F2O |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (3E,5Z)-4-(difluoromethoxy)-5-ethylidene-7-methylocta-1,3-diene |
| SMILES | C=C/C=C(OC(F)F)\C(=C/C)CC(C)C |
| InChI | InChI=1S/C12H18F2O/c1-5-7-11(15-12(13)14)10(6-2)8-9(3)4/h5-7,9,12H,1,8H2,2-4H3/b10-6-,11-7+ |
| InChIKey | AWFCDUOGPBZQPE-NAKBGQTNSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|