C12H12N2O — CID 143251055
2-(4-methylcyclohepta-1,3,6-trien-1-yl)oxypyrimidine (PubChem CID 143251055) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-(4-methylcyclohepta-1,3,6-trien-1-yl)oxypyrimidine.
| Compound Name | 2-(4-methylcyclohepta-1,3,6-trien-1-yl)oxypyrimidine |
|---|---|
| PubChem CID | 143251055 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2-(4-methylcyclohepta-1,3,6-trien-1-yl)oxypyrimidine |
| SMILES | CC1=CC=C(Oc2ncccn2)C=CC1 |
| InChI | InChI=1S/C12H12N2O/c1-10-4-2-5-11(7-6-10)15-12-13-8-3-9-14-12/h2-3,5-9H,4H2,1H3 |
| InChIKey | IDUVXVFTNGLAGC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |