C17H21N3O2 — CID 143251064
2-methyl-6-[4-(pyrimidin-2-ylamino)phenyl]hexanoic acid (PubChem CID 143251064) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-methyl-6-[4-(pyrimidin-2-ylamino)phenyl]hexanoic acid.
| Compound Name | 2-methyl-6-[4-(pyrimidin-2-ylamino)phenyl]hexanoic acid |
|---|---|
| PubChem CID | 143251064 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-methyl-6-[4-(pyrimidin-2-ylamino)phenyl]hexanoic acid |
| SMILES | CC(CCCCc1ccc(Nc2ncccn2)cc1)C(=O)O |
| InChI | InChI=1S/C17H21N3O2/c1-13(16(21)22)5-2-3-6-14-7-9-15(10-8-14)20-17-18-11-4-12-19-17/h4,7-13H,2-3,5-6H2,1H3,(H,21,22)(H,18,19,20) |
| InChIKey | KTHYKPPPQGRBSN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|