C22H24N4O3S — CID 143251867
4-azatricyclo[5.2.0.01,4]nonan-6-yl 6-(5-methyl-1,3-thiazol-2-yl)-1H-indazole-3-carboxylate;ethenol (PubChem CID 143251867) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is 4-azatricyclo[5.2.0.01,4]nonan-6-yl 6-(5-methyl-1,3-thiazol-2-yl)-1H-indazole-3-carboxylate;ethenol.
| Compound Name | 4-azatricyclo[5.2.0.01,4]nonan-6-yl 6-(5-methyl-1,3-thiazol-2-yl)-1H-indazole-3-carboxylate;ethenol |
|---|---|
| PubChem CID | 143251867 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 4-azatricyclo[5.2.0.01,4]nonan-6-yl 6-(5-methyl-1,3-thiazol-2-yl)-1H-indazole-3-carboxylate;ethenol |
| SMILES | C=CO.Cc1cnc(-c2ccc3c(C(=O)OC4CN5CCC56CCC46)n[nH]c3c2)s1 |
| InChI | InChI=1S/C20H20N4O2S.C2H4O/c1-11-9-21-18(27-11)12-2-3-13-15(8-12)22-23-17(13)19(25)26-16-10-24-7-6-20(24)5-4-14(16)20;1-2-3/h2-3,8-9,14,16H,4-7,10H2,1H3,(H,22,23);2-3H,1H2 |
| InChIKey | PJFCYCCPAKROEX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|