C26H32F6N6O2 — CID 143252053
ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-[(E)-N'-(methylamino)carbamimidoyl]amino]-2-ethyl-6,8-dimethyl-3,4-dihydro-2H-1,7-naphthyridine-1-carboxylate (PubChem CID 143252053) has the molecular formula C26H32F6N6O2 and a molecular weight of 574.57 g/mol. Its IUPAC name is ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-[(E)-N'-(methylamino)carbamimidoyl]amino]-2-ethyl-6,8-dimethyl-3,4-dihydro-2H-1,7-naphthyridine-1-carboxylate.
| Compound Name | ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-[(E)-N'-(methylamino)carbamimidoyl]amino]-2-ethyl-6,8-dimethyl-3,4-dihydro-2H-1,7-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 143252053 |
| Molecular Formula | C26H32F6N6O2 |
| Molecular Weight | 574.57 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-[(E)-N'-(methylamino)carbamimidoyl]amino]-2-ethyl-6,8-dimethyl-3,4-dihydro-2H-1,7-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)N1c2c(cc(C)nc2C)C(N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)/C(N)=N/NC)CC1CC |
| InChI | InChI=1S/C26H32F6N6O2/c1-6-19-12-21(20-8-14(3)35-15(4)22(20)38(19)24(39)40-7-2)37(23(33)36-34-5)13-16-9-17(25(27,28)29)11-18(10-16)26(30,31)32/h8-11,19,21,34H,6-7,12-13H2,1-5H3,(H2,33,36) |
| InChIKey | OZVBRUIWBFOHGT-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|