C29H38Br2O4S — CID 143252322
2,6-dibromo-4-[(Z)-2-hydroxysulfanylbut-1-enyl]phenol;2,2,5,7,8-pentamethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromene (PubChem CID 143252322) has the molecular formula C29H38Br2O4S and a molecular weight of 642.49 g/mol. Its IUPAC name is 2,6-dibromo-4-[(Z)-2-hydroxysulfanylbut-1-enyl]phenol;2,2,5,7,8-pentamethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromene.
| Compound Name | 2,6-dibromo-4-[(Z)-2-hydroxysulfanylbut-1-enyl]phenol;2,2,5,7,8-pentamethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromene |
|---|---|
| PubChem CID | 143252322 |
| Molecular Formula | C29H38Br2O4S |
| Molecular Weight | 642.49 g/mol |
| Exact Mass | 640.09 |
| IUPAC Name | 2,6-dibromo-4-[(Z)-2-hydroxysulfanylbut-1-enyl]phenol;2,2,5,7,8-pentamethyl-6-(3-methylbut-2-enoxy)-3,4-dihydrochromene |
| SMILES | CC(C)=CCOc1c(C)c(C)c2c(c1C)CCC(C)(C)O2.CC/C(=C/c1cc(Br)c(O)c(Br)c1)SO |
| InChI | InChI=1S/C19H28O2.C10H10Br2O2S/c1-12(2)9-11-20-17-13(3)14(4)18-16(15(17)5)8-10-19(6,7)21-18;1-2-7(15-14)3-6-4-8(11)10(13)9(12)5-6/h9H,8,10-11H2,1-7H3;3-5,13-14H,2H2,1H3/b;7-3- |
| InChIKey | WVMOWURBFLTEKO-KEAXFFGOSA-N |
| XLogP | 9.93 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.49 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|