About (3Z)-N-methyl-N-(2-methylheptan-4-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine
(3Z)-N-methyl-N-(2-methylheptan-4-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine (PubChem CID 143252754) has the molecular formula C18H33N
and a molecular weight of 263.47 g/mol. Its IUPAC name is (3Z)-N-methyl-N-(2-methylheptan-4-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine.
Molecular Properties
| Compound Name | (3Z)-N-methyl-N-(2-methylheptan-4-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine |
| PubChem CID | 143252754 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | (3Z)-N-methyl-N-(2-methylheptan-4-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine |
| SMILES | C=C/C=C(\C=C/C)CCN(C)C(CCC)CC(C)C |
| InChI | InChI=1S/C18H33N/c1-7-10-17(11-8-2)13-14-19(6)18(12-9-3)15-16(4)5/h7-8,10-11,16,18H,1,9,12-15H2,2-6H3/b11-8-,17-10+ |
| InChIKey | IXQOPGHZBKLPFN-ULGOZLGSSA-N |
| XLogP | 5.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-N-methyl-N-(2-methylheptan-4-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-N-methyl-N-(2-methylheptan-4-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine?
The IUPAC name of (3Z)-N-methyl-N-(2-methylheptan-4-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine (CID 143252754) is (3Z)-N-methyl-N-(2-methylheptan-4-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine.
What is the SMILES notation for (3Z)-N-methyl-N-(2-methylheptan-4-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine?
The canonical SMILES for (3Z)-N-methyl-N-(2-methylheptan-4-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine is C=C/C=C(\C=C/C)CCN(C)C(CCC)CC(C)C.
What is the InChIKey of (3Z)-N-methyl-N-(2-methylheptan-4-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine?
The InChIKey is IXQOPGHZBKLPFN-ULGOZLGSSA-N. The full InChI is InChI=1S/C18H33N/c1-7-10-17(11-8-2)13-14-19(6)18(12-9-3)15-16(4)5/h7-8,10-11,16,18H,1,9,12-15H2,2-6H3/b11-8-,17-10+.
What are the key properties of (3Z)-N-methyl-N-(2-methylheptan-4-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine?
(3Z)-N-methyl-N-(2-methylheptan-4-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine has a molecular weight of 263.47 g/mol, XLogP of 5.21, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-N-methyl-N-(2-methylheptan-4-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine is sourced from PubChem (CID 143252754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).