About 5-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)cycloheptyl]sulfonyl-2-fluorobenzoic acid
5-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)cycloheptyl]sulfonyl-2-fluorobenzoic acid (PubChem CID 143253412) has the molecular formula C24H28FNO4S
and a molecular weight of 445.56 g/mol. Its IUPAC name is 5-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)cycloheptyl]sulfonyl-2-fluorobenzoic acid.
Molecular Properties
| Compound Name | 5-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)cycloheptyl]sulfonyl-2-fluorobenzoic acid |
| PubChem CID | 143253412 |
| Molecular Formula | C24H28FNO4S |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 5-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)cycloheptyl]sulfonyl-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)C2CCCC(CN3CCc4ccccc4C3)CC2)ccc1F |
| InChI | InChI=1S/C24H28FNO4S/c25-23-11-10-21(14-22(23)24(27)28)31(29,30)20-7-3-4-17(8-9-20)15-26-13-12-18-5-1-2-6-19(18)16-26/h1-2,5-6,10-11,14,17,20H,3-4,7-9,12-13,15-16H2,(H,27,28) |
| InChIKey | DNLVEYNXHIYULF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)cycloheptyl]sulfonyl-2-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)cycloheptyl]sulfonyl-2-fluorobenzoic acid?
The IUPAC name of 5-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)cycloheptyl]sulfonyl-2-fluorobenzoic acid (CID 143253412) is 5-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)cycloheptyl]sulfonyl-2-fluorobenzoic acid.
What is the SMILES notation for 5-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)cycloheptyl]sulfonyl-2-fluorobenzoic acid?
The canonical SMILES for 5-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)cycloheptyl]sulfonyl-2-fluorobenzoic acid is O=C(O)c1cc(S(=O)(=O)C2CCCC(CN3CCc4ccccc4C3)CC2)ccc1F.
What is the InChIKey of 5-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)cycloheptyl]sulfonyl-2-fluorobenzoic acid?
The InChIKey is DNLVEYNXHIYULF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28FNO4S/c25-23-11-10-21(14-22(23)24(27)28)31(29,30)20-7-3-4-17(8-9-20)15-26-13-12-18-5-1-2-6-19(18)16-26/h1-2,5-6,10-11,14,17,20H,3-4,7-9,12-13,15-16H2,(H,27,28).
What are the key properties of 5-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)cycloheptyl]sulfonyl-2-fluorobenzoic acid?
5-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)cycloheptyl]sulfonyl-2-fluorobenzoic acid has a molecular weight of 445.56 g/mol, XLogP of 4.30, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)cycloheptyl]sulfonyl-2-fluorobenzoic acid is sourced from PubChem (CID 143253412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).