About 6-iodo-6-methylpyrido[2,3-b]azepine
6-iodo-6-methylpyrido[2,3-b]azepine (PubChem CID 143253986) has the molecular formula C10H9IN2
and a molecular weight of 284.10 g/mol. Its IUPAC name is 6-iodo-6-methylpyrido[2,3-b]azepine.
Molecular Properties
| Compound Name | 6-iodo-6-methylpyrido[2,3-b]azepine |
| PubChem CID | 143253986 |
| Molecular Formula | C10H9IN2 |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 6-iodo-6-methylpyrido[2,3-b]azepine |
| SMILES | CC1(I)C=CN=c2ncccc2=C1 |
| InChI | InChI=1S/C10H9IN2/c1-10(11)4-6-13-9-8(7-10)3-2-5-12-9/h2-7H,1H3 |
| InChIKey | WTJUBWDGXNSJNH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-6-methylpyrido[2,3-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-6-methylpyrido[2,3-b]azepine?
The IUPAC name of 6-iodo-6-methylpyrido[2,3-b]azepine (CID 143253986) is 6-iodo-6-methylpyrido[2,3-b]azepine.
What is the SMILES notation for 6-iodo-6-methylpyrido[2,3-b]azepine?
The canonical SMILES for 6-iodo-6-methylpyrido[2,3-b]azepine is CC1(I)C=CN=c2ncccc2=C1.
What is the InChIKey of 6-iodo-6-methylpyrido[2,3-b]azepine?
The InChIKey is WTJUBWDGXNSJNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9IN2/c1-10(11)4-6-13-9-8(7-10)3-2-5-12-9/h2-7H,1H3.
What are the key properties of 6-iodo-6-methylpyrido[2,3-b]azepine?
6-iodo-6-methylpyrido[2,3-b]azepine has a molecular weight of 284.10 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-6-methylpyrido[2,3-b]azepine is sourced from PubChem (CID 143253986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).